4-(4,5,6,7-TETRAHYDROTHIAZOLO[5,4-C]PYRIDIN-2-YL)PHENOL

pro_cas
1174738-34-1
pro_cdbregno
CCD03174922
pro_formula
C12 H12 N2 O S
pro_molWeight
232.306

basic_info

Product_Name: 4-(4,5,6,7-TETRAHYDROTHIAZOLO[5,4-C]PYRIDIN-2-YL)PHENOL
CAS: 1174738-34-1
EnglishSynonyms: 4-(4,5,6,7-TETRAHYDROTHIAZOLO[5,4-C]PYRIDIN-2-YL)PHENOL
pro_mdlNumber: MFCD16794828
pro_acceptors: 3
pro_donors: 2
pro_smile: c1cc(ccc1c2nc3c(s2)CNCC3)O
InChi: InChI=1S/C12H12N2OS/c15-9-3-1-8(2-4-9)12-14-10-5-6-13-7-11(10)16-12/h1-4,13,15H,5-7H2
InChiKey: InChIKey=ALHQMCVTOYKMJQ-UHFFFAOYSA-N