7-ETHYL-5-(4-METHOXY-PHENYL)-8-METHYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE

pro_cas
pro_cdbregno
CCD03193330
pro_formula
C15 H16 N4 O2
pro_molWeight
284.317

basic_info

Product_Name: 7-ETHYL-5-(4-METHOXY-PHENYL)-8-METHYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE
EnglishSynonyms: 7-ETHYL-5-(4-METHOXY-PHENYL)-8-METHYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE
pro_mdlNumber: MFCD16813238
pro_acceptors: 6
pro_donors: 1
pro_smile: CCc1c(c2n[nH]c(=O)n2c(n1)c3ccc(cc3)OC)C
InChi: InChI=1S/C15H16N4O2/c1-4-12-9(2)13-17-18-15(20)19(13)14(16-12)10-5-7-11(21-3)8-6-10/h5-8H,4H2,1-3H3,(H,18,20)
InChiKey: InChIKey=WJDNZKUMJMKGCN-UHFFFAOYSA-N