SELENA SEL10871685

pro_cas
pro_cdbregno
CCD03212946
pro_formula
C8 H8 Cl2 N2 O2 S2
pro_molWeight
299.201

basic_info

Product_Name: SELENA SEL10871685
EnglishSynonyms: SELENA SEL10871685
pro_mdlNumber: MFCD16832875
pro_acceptors: 4
pro_donors: 1
pro_smile: c1c(c(sc1Cl)Cl)S(=O)(=O)NCCCC#N
InChi: InChI=1S/C8H8Cl2N2O2S2/c9-7-5-6(8(10)15-7)16(13,14)12-4-2-1-3-11/h5,12H,1-2,4H2
InChiKey: InChIKey=PJRCYSSYQGUWPW-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.