SELENA SEL10871686

pro_cas
pro_cdbregno
CCD03212951
pro_formula
C8 H12 N4 O2 S
pro_molWeight
228.275

basic_info

Product_Name: SELENA SEL10871686
EnglishSynonyms: SELENA SEL10871686
pro_mdlNumber: MFCD16832880
pro_acceptors: 6
pro_donors: 1
pro_smile: Cn1cc(cn1)S(=O)(=O)NCCCC#N
InChi: InChI=1S/C8H12N4O2S/c1-12-7-8(6-10-12)15(13,14)11-5-3-2-4-9/h6-7,11H,2-3,5H2,1H3
InChiKey: InChIKey=FAUSFIVLPRDWSH-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.