SELENA SEL10871762

pro_cas
pro_cdbregno
CCD03215278
pro_formula
C9 H11 Cl N2 O2 S2
pro_molWeight
278.783

basic_info

Product_Name: SELENA SEL10871762
EnglishSynonyms: SELENA SEL10871762
pro_mdlNumber: MFCD16835207
pro_acceptors: 4
pro_donors: 1
pro_smile: CCC(CC#N)NS(=O)(=O)c1ccc(s1)Cl
InChi: InChI=1S/C9H11ClN2O2S2/c1-2-7(5-6-11)12-16(13,14)9-4-3-8(10)15-9/h3-4,7,12H,2,5H2,1H3
InChiKey: InChIKey=JPDVIQLCOZJJFJ-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.