SELENA SEL10871763

pro_cas
pro_cdbregno
CCD03215283
pro_formula
C9 H14 N4 O2 S
pro_molWeight
242.302

basic_info

Product_Name: SELENA SEL10871763
EnglishSynonyms: SELENA SEL10871763
pro_mdlNumber: MFCD16835212
pro_acceptors: 6
pro_donors: 1
pro_smile: CCC(CC#N)NS(=O)(=O)c1cn(cn1)C
InChi: InChI=1S/C9H14N4O2S/c1-3-8(4-5-10)12-16(14,15)9-6-13(2)7-11-9/h6-8,12H,3-4H2,1-2H3
InChiKey: InChIKey=YLGURZJXYAVSEG-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.