3-(3,5-DIMETHYL-1H-PYRAZOL-1-YL)PYRAZINE-2-CARBOTHIOAMIDE

pro_cas
pro_cdbregno
CCD03223791
pro_formula
C10 H11 N5 S
pro_molWeight
233.298

basic_info

Product_Name: 3-(3,5-DIMETHYL-1H-PYRAZOL-1-YL)PYRAZINE-2-CARBOTHIOAMIDE
EnglishSynonyms: 3-(3,5-DIMETHYL-1H-PYRAZOL-1-YL)PYRAZINE-2-CARBOTHIOAMIDE
pro_mdlNumber: MFCD16843720
pro_acceptors: 5
pro_donors: 1
pro_smile: Cc1cc(n(n1)c2c(nccn2)C(=S)N)C
InChi: InChI=1S/C10H11N5S/c1-6-5-7(2)15(14-6)10-8(9(11)16)12-3-4-13-10/h3-5H,1-2H3,(H2,11,16)
InChiKey: InChIKey=QZFJRDJHNYFLOM-UHFFFAOYSA-N