METHYL 2-(PENT-4-ENAMIDO)ACETATE

pro_cas
pro_cdbregno
CCD03224398
pro_formula
C8 H13 N O3
pro_molWeight
171.195

basic_info

Product_Name: METHYL 2-(PENT-4-ENAMIDO)ACETATE
EnglishSynonyms: METHYL 2-(PENT-4-ENAMIDO)ACETATE
pro_mdlNumber: MFCD16844327
pro_acceptors: 4
pro_donors: 1
pro_smile: COC(=O)CNC(=O)CCC=C
InChi: InChI=1S/C8H13NO3/c1-3-4-5-7(10)9-6-8(11)12-2/h3H,1,4-6H2,2H3,(H,9,10)
InChiKey: InChIKey=JLXCJNZHDJWTNU-UHFFFAOYSA-N