6-CHLORO-N-(2-METHYLBUTYL)PYRIMIDIN-4-AMINE

pro_cas
1249721-06-9
pro_cdbregno
CCD03229671
pro_formula
C9 H14 Cl N3
pro_molWeight
199.684

basic_info

Product_Name: 6-CHLORO-N-(2-METHYLBUTYL)PYRIMIDIN-4-AMINE
CAS: 1249721-06-9
EnglishSynonyms: 6-CHLORO-N-(2-METHYLBUTYL)PYRIMIDIN-4-AMINE
pro_mdlNumber: MFCD16849600
pro_acceptors: 3
pro_donors: 1
pro_smile: CCC(C)CNc1cc(ncn1)Cl
InChi: InChI=1S/C9H14ClN3/c1-3-7(2)5-11-9-4-8(10)12-6-13-9/h4,6-7H,3,5H2,1-2H3,(H,11,12,13)
InChiKey: InChIKey=AOBHXAFJLRDEKT-UHFFFAOYSA-N