2-[(BUTAN-2-YL)AMINO]-4-METHYLBENZOIC ACID

pro_cas
pro_cdbregno
CCD03232579
pro_formula
C12 H17 N O2
pro_molWeight
207.271

basic_info

Product_Name: 2-[(BUTAN-2-YL)AMINO]-4-METHYLBENZOIC ACID
EnglishSynonyms: 2-[(BUTAN-2-YL)AMINO]-4-METHYLBENZOIC ACID
pro_mdlNumber: MFCD16852508
pro_acceptors: 3
pro_donors: 2
pro_smile: CCC(C)Nc1cc(ccc1C(=O)O)C
InChi: InChI=1S/C12H17NO2/c1-4-9(3)13-11-7-8(2)5-6-10(11)12(14)15/h5-7,9,13H,4H2,1-3H3,(H,14,15)
InChiKey: InChIKey=HVNGNXHPJLPIFB-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.