2-(4-AMINO-5-METHYL-1H-PYRAZOL-1-YL)CYCLOPENTAN-1-OL

pro_cas
1340536-98-2
pro_cdbregno
CCD03234884
pro_formula
C9 H15 N3 O
pro_molWeight
181.238

basic_info

Product_Name: 2-(4-AMINO-5-METHYL-1H-PYRAZOL-1-YL)CYCLOPENTAN-1-OL
CAS: 1340536-98-2
EnglishSynonyms: 2-(4-AMINO-5-METHYL-1H-PYRAZOL-1-YL)CYCLOPENTANOL ; 2-(4-AMINO-5-METHYL-1H-PYRAZOL-1-YL)CYCLOPENTAN-1-OL
pro_mdlNumber: MFCD16854813
pro_acceptors: 4
pro_donors: 2
pro_smile: Cc1c(cnn1C2CCCC2O)N
InChi: InChI=1S/C9H15N3O/c1-6-7(10)5-11-12(6)8-3-2-4-9(8)13/h5,8-9,13H,2-4,10H2,1H3
InChiKey: InChIKey=CNKCYDXVSPVHLH-UHFFFAOYSA-N