(3-ETHYLOXOLAN-3-YL)METHANAMINE

pro_cas
1158760-31-6
pro_cdbregno
CCD03236463
pro_formula
C7 H15 N O
pro_molWeight
129.202

basic_info

Product_Name: (3-ETHYLOXOLAN-3-YL)METHANAMINE
CAS: 1158760-31-6
EnglishSynonyms: (3-ETHYLOXOLAN-3-YL)METHANAMINE ; 3-(AMINOMETHYL)-3-ETHYL-OXOLANE ; (3-ETHYL-TETRAHYDROFURAN-3-YL)METHANAMINE
pro_mdlNumber: MFCD16856392
pro_acceptors: 2
pro_donors: 1
pro_smile: CCC1(CCOC1)CN
InChi: InChI=1S/C7H15NO/c1-2-7(5-8)3-4-9-6-7/h2-6,8H2,1H3
InChiKey: InChIKey=PFXSONMLECXXAE-UHFFFAOYSA-N