ABAMACHEM ABA-6295031

pro_cas
pro_cdbregno
CCD03239927
pro_formula
C9 H10 Br N3 O2 S
pro_molWeight
304.167

basic_info

Product_Name: ABAMACHEM ABA-6295031
EnglishSynonyms: ABAMACHEM ABA-6295031
pro_mdlNumber: MFCD16859856
pro_acceptors: 5
pro_donors: 1
pro_smile: CC(CNS(=O)(=O)c1cc(cnc1)Br)C#N
InChi: InChI=1S/C9H10BrN3O2S/c1-7(3-11)4-13-16(14,15)9-2-8(10)5-12-6-9/h2,5-7,13H,4H2,1H3
InChiKey: InChIKey=TYDCRLUBKJKNKU-UHFFFAOYSA-N