ABAMACHEM ABA-6098213

pro_cas
pro_cdbregno
CCD03239933
pro_formula
C9 H11 Br N2 O2 S2
pro_molWeight
323.234

basic_info

Product_Name: ABAMACHEM ABA-6098213
EnglishSynonyms: ABAMACHEM ABA-6098213
pro_mdlNumber: MFCD16859862
pro_acceptors: 4
pro_donors: 1
pro_smile: CCC(CC#N)NS(=O)(=O)c1c(ccs1)Br
InChi: InChI=1S/C9H11BrN2O2S2/c1-2-7(3-5-11)12-16(13,14)9-8(10)4-6-15-9/h4,6-7,12H,2-3H2,1H3
InChiKey: InChIKey=ZUZGFGVIFYAWSO-UHFFFAOYSA-N