ABAMACHEM ABA-6294760

pro_cas
pro_cdbregno
CCD03239961
pro_formula
C9 H10 N4 O2 S
pro_molWeight
238.27

basic_info

Product_Name: ABAMACHEM ABA-6294760
EnglishSynonyms: ABAMACHEM ABA-6294760
pro_mdlNumber: MFCD16859890
pro_acceptors: 6
pro_donors: 1
pro_smile: c1cnc(c(n1)C#N)NC2CCS(=O)(=O)C2
InChi: InChI=1S/C9H10N4O2S/c10-5-8-9(12-3-2-11-8)13-7-1-4-16(14,15)6-7/h2-3,7H,1,4,6H2,(H,12,13)
InChiKey: InChIKey=MWAKHKKKJKQZNM-UHFFFAOYSA-N