1-ETHYLCYCLOPENTANE-1-CARBOXYLIC ACID

pro_cas
17206-19-8
pro_cdbregno
CCD03240566
pro_formula
C8 H14 O2
pro_molWeight
142.197

basic_info

Product_Name: 1-ETHYLCYCLOPENTANE-1-CARBOXYLIC ACID
CAS: 17206-19-8
EnglishSynonyms: 1-ETHYLCYCLOPENTANE-1-CARBOXYLIC ACID ; 1-ETHYLCYCLOPENTANECARBOXYLIC ACID
pro_mdlNumber: MFCD16860495
pro_acceptors: 2
pro_donors: 1
pro_smile: CCC1(CCCC1)C(=O)O
InChi: InChI=1S/C8H14O2/c1-2-8(7(9)10)5-3-4-6-8/h2-6H2,1H3,(H,9,10)
InChiKey: InChIKey=CUMLHEATBNFNNU-UHFFFAOYSA-N