4-(5-ACETYL-1,3-THIAZOL-2-YL)PIPERAZIN-2-ONE

pro_cas
pro_cdbregno
CCD03249719
pro_formula
C9 H11 N3 O2 S
pro_molWeight
225.271

basic_info

Product_Name: 4-(5-ACETYL-1,3-THIAZOL-2-YL)PIPERAZIN-2-ONE
EnglishSynonyms: 4-(5-ACETYL-1,3-THIAZOL-2-YL)PIPERAZIN-2-ONE
pro_mdlNumber: MFCD16869649
pro_acceptors: 5
pro_donors: 1
pro_smile: CC(=O)c1cnc(s1)N2CCNC(=O)C2
InChi: InChI=1S/C9H11N3O2S/c1-6(13)7-4-11-9(15-7)12-3-2-10-8(14)5-12/h4H,2-3,5H2,1H3,(H,10,14)
InChiKey: InChIKey=WJMXPRALLIANOO-UHFFFAOYSA-N