1-[2-(DIPROPYLAMINO)-1,3-THIAZOL-5-YL]ETHAN-1-ONE

pro_cas
pro_cdbregno
CCD03249722
pro_formula
C11 H18 N2 O S
pro_molWeight
226.342

basic_info

Product_Name: 1-[2-(DIPROPYLAMINO)-1,3-THIAZOL-5-YL]ETHAN-1-ONE
EnglishSynonyms: 1-[2-(DIPROPYLAMINO)-1,3-THIAZOL-5-YL]ETHAN-1-ONE
pro_mdlNumber: MFCD16869652
pro_acceptors: 3
pro_donors: 0
pro_smile: CCCN(CCC)c1ncc(s1)C(=O)C
InChi: InChI=1S/C11H18N2OS/c1-4-6-13(7-5-2)11-12-8-10(15-11)9(3)14/h8H,4-7H2,1-3H3
InChiKey: InChIKey=CVHLSGCUTVTUJA-UHFFFAOYSA-N