7-(PROPAN-2-YL)-2H,3H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE

pro_cas
pro_cdbregno
CCD03252434
pro_formula
C8 H10 N4 O
pro_molWeight
178.194

basic_info

Product_Name: 7-(PROPAN-2-YL)-2H,3H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE
EnglishSynonyms: 7-(PROPAN-2-YL)-2H,3H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE ; 7-ISOPROPYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE
pro_mdlNumber: MFCD16872368
pro_acceptors: 5
pro_donors: 1
pro_smile: CC(C)c1cc2n[nH]c(=O)n2cn1
InChi: InChI=1S/C8H10N4O/c1-5(2)6-3-7-10-11-8(13)12(7)4-9-6/h3-5H,1-2H3,(H,11,13)
InChiKey: InChIKey=RAWKVTGWVGCSDZ-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.