7-ETHYL-5-P-TOLYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE

pro_cas
pro_cdbregno
CCD03252441
pro_formula
C14 H14 N4 O
pro_molWeight
254.292

basic_info

Product_Name: 7-ETHYL-5-P-TOLYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE
EnglishSynonyms: 7-ETHYL-5-P-TOLYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE
pro_mdlNumber: MFCD16872375
pro_acceptors: 5
pro_donors: 1
pro_smile: CCc1cc2n[nH]c(=O)n2c(n1)c3ccc(cc3)C
InChi: InChI=1S/C14H14N4O/c1-3-11-8-12-16-17-14(19)18(12)13(15-11)10-6-4-9(2)5-7-10/h4-8H,3H2,1-2H3,(H,17,19)
InChiKey: InChIKey=TWQKFNDEWNZHPQ-UHFFFAOYSA-N