ZERENEX E/1100129

pro_cas
pro_cdbregno
CCD03253293
pro_formula
C10 H9 N3 O2
pro_molWeight
203.2

basic_info

Product_Name: ZERENEX E/1100129
EnglishSynonyms: ZERENEX E/1100129
pro_mdlNumber: MFCD16873227
pro_acceptors: 5
pro_donors: 0
pro_smile: c1cc2c(cc1n3cnnc3)OCCO2
InChi: InChI=1S/C10H9N3O2/c1-2-9-10(15-4-3-14-9)5-8(1)13-6-11-12-7-13/h1-2,5-7H,3-4H2
InChiKey: InChIKey=HYWGYCKZCZVPDI-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.