ZERENEX E/1101506

pro_cas
pro_cdbregno
CCD03254150
pro_formula
C17 H20 N2 O2
pro_molWeight
284.357

basic_info

Product_Name: ZERENEX E/1101506
EnglishSynonyms: ZERENEX E/1101506
pro_mdlNumber: MFCD16874084
pro_acceptors: 4
pro_donors: 2
pro_smile: CCOc1ccc(cc1)C(=O)Nc2c(cc(cc2C)N)C
InChi: InChI=1S/C17H20N2O2/c1-4-21-15-7-5-13(6-8-15)17(20)19-16-11(2)9-14(18)10-12(16)3/h5-10H,4,18H2,1-3H3,(H,19,20)
InChiKey: InChIKey=KFWGTMGKBDJEPK-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.