C23 H24 N2 O4


CAS: 1228095-71-3
pro_mdlNumber: MFCD16883044
pro_acceptors: 6
pro_donors: 1
pro_smile: COC(=O)[C@@H]1C[C@H](CN1Cc2cn(c(=O)c3c2cccc3)Cc4ccccc4)O
InChi: InChI=1S/C23H24N2O4/c1-29-23(28)21-11-18(26)15-24(21)13-17-14-25(12-16-7-3-2-4-8-16)22(27)20-10-6-5-9-19(17)20/h2-10,14,18,21,26H,11-13,15H2,1H3/t18-,21+/m1/s1