6-FLUORO-2-(PIPERAZIN-1-YLMETHYL)QUINOLINE HYDROCHLORIDE

pro_cas
1228095-60-0
pro_cdbregno
CCD03259068
pro_formula
C14 H16 F N3 . Cl H
pro_molWeight
281.76

basic_info

Product_Name: 6-FLUORO-2-(PIPERAZIN-1-YLMETHYL)QUINOLINE HYDROCHLORIDE
CAS: 1228095-60-0
EnglishSynonyms: 6-FLUORO-2-(PIPERAZIN-1-YLMETHYL)QUINOLINE HYDROCHLORIDE
pro_mdlNumber: MFCD16883045
pro_acceptors: 3
pro_donors: 1
pro_smile: c1cc(nc2c1cc(cc2)F)CN3CCNCC3.Cl
InChi: InChI=1S/C14H16FN3.ClH/c15-12-2-4-14-11(9-12)1-3-13(17-14)10-18-7-5-16-6-8-18;/h1-4,9,16H,5-8,10H2;1H
InChiKey: InChIKey=YJACDKLZRKMNFJ-UHFFFAOYSA-N