4-(2-BENZYL-1-OXO-1,2-DIHYDROISOQUINOLIN-4-YLMETHYL)PIPERAZINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER

pro_cas
1228095-61-1
pro_cdbregno
CCD03259069
pro_formula
C26 H31 N3 O3
pro_molWeight
433.549

basic_info

Product_Name: 4-(2-BENZYL-1-OXO-1,2-DIHYDROISOQUINOLIN-4-YLMETHYL)PIPERAZINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS: 1228095-61-1
EnglishSynonyms: 4-(2-BENZYL-1-OXO-1,2-DIHYDROISOQUINOLIN-4-YLMETHYL)PIPERAZINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER ; TERT-BUTYL 4-[(2-BENZYL-1-OXO-1,2-DIHYDROISOQUINOLIN-4-YL)METHYL]PIPERAZINE-1-CARBOXYLATE
pro_mdlNumber: MFCD16883046
pro_acceptors: 6
pro_donors: 0
pro_smile: CC(C)(C)OC(=O)N1CCN(CC1)Cc2cn(c(=O)c3c2cccc3)Cc4ccccc4
InChi: InChI=1S/C26H31N3O3/c1-26(2,3)32-25(31)28-15-13-27(14-16-28)18-21-19-29(17-20-9-5-4-6-10-20)24(30)23-12-8-7-11-22(21)23/h4-12,19H,13-18H2,1-3H3
InChiKey: InChIKey=MXWFWSGVWHIPFX-UHFFFAOYSA-N