4-CHLOROISOQUINOLIN-1-YLAMINE HYDROCHLORIDE

pro_cas
1228095-62-2
pro_cdbregno
CCD03259071
pro_formula
C9 H7 Cl N2 . Cl H
pro_molWeight
215.082

basic_info

Product_Name: 4-CHLOROISOQUINOLIN-1-YLAMINE HYDROCHLORIDE
CAS: 1228095-62-2
EnglishSynonyms: 4-CHLOROISOQUINOLIN-1-YLAMINE HYDROCHLORIDE
pro_mdlNumber: MFCD16883048
pro_acceptors: 2
pro_donors: 1
pro_smile: c1ccc2c(c1)c(cnc2N)Cl.Cl
InChi: InChI=1S/C9H7ClN2.ClH/c10-8-5-12-9(11)7-4-2-1-3-6(7)8;/h1-5H,(H2,11,12);1H
InChiKey: InChIKey=SRWIIZIZNSMFTJ-UHFFFAOYSA-N