2-[1-(6-FLUOROQUINOLIN-2-YLMETHYL)PIPERIDIN-4-YL]ACETIC ACID METHYL ESTER

pro_cas
1228095-63-3
pro_cdbregno
CCD03259072
pro_formula
C18 H21 F N2 O2
pro_molWeight
316.374

basic_info

Product_Name: 2-[1-(6-FLUOROQUINOLIN-2-YLMETHYL)PIPERIDIN-4-YL]ACETIC ACID METHYL ESTER
CAS: 1228095-63-3
EnglishSynonyms: METHYL 2-(1-[(6-FLUOROQUINOLIN-2-YL)METHYL]PIPERIDIN-4-YL)ACETATE ; 2-[1-(6-FLUOROQUINOLIN-2-YLMETHYL)PIPERIDIN-4-YL]ACETIC ACID METHYL ESTER
pro_mdlNumber: MFCD16883049
pro_acceptors: 4
pro_donors: 0
pro_smile: COC(=O)CC1CCN(CC1)Cc2ccc3cc(ccc3n2)F
InChi: InChI=1S/C18H21FN2O2/c1-23-18(22)10-13-6-8-21(9-7-13)12-16-4-2-14-11-15(19)3-5-17(14)20-16/h2-5,11,13H,6-10,12H2,1H3
InChiKey: InChIKey=LWBNKPYMTXWLJK-UHFFFAOYSA-N