2-((4-[(2E)-3-(4-BROMOPHENYL)PROP-2-EN-1-YL]PIPERAZIN-1-YL)METHYL)-6-FLUOROQUINOLINE

pro_cas
1228095-73-5
pro_cdbregno
CCD03259073
pro_formula
C23 H23 Br F N3
pro_molWeight
440.358

basic_info

Product_Name: 2-((4-[(2E)-3-(4-BROMOPHENYL)PROP-2-EN-1-YL]PIPERAZIN-1-YL)METHYL)-6-FLUOROQUINOLINE
CAS: 1228095-73-5
EnglishSynonyms: 2-(4-[(2E)-3-(4-BROMOPHENYL)ALLYL]PIPERAZIN-1-YLMETHYL)6-FLUOROQUINOLINE ; 2-((4-[(2E)-3-(4-BROMOPHENYL)PROP-2-EN-1-YL]PIPERAZIN-1-YL)METHYL)-6-FLUOROQUINOLINE
pro_mdlNumber: MFCD16883050
pro_acceptors: 3
pro_donors: 0
pro_smile: c1cc(ccc1/C=C/CN2CCN(CC2)Cc3ccc4cc(ccc4n3)F)Br
InChi: InChI=1S/C23H23BrFN3/c24-20-6-3-18(4-7-20)2-1-11-27-12-14-28(15-13-27)17-22-9-5-19-16-21(25)8-10-23(19)26-22/h1-10,16H,11-15,17H2/b2-1+
InChiKey: InChIKey=QMQBZXJOEAWNJD-OWOJBTEDSA-N