4-(6-FLUOROQUINOLIN-2-YLMETHYL)PIPERAZINE-1-CARBOXYLIC ACID ETHYL ESTER

pro_cas
1228095-64-4
pro_cdbregno
CCD03259074
pro_formula
C17 H20 F N3 O2
pro_molWeight
317.362

basic_info

Product_Name: 4-(6-FLUOROQUINOLIN-2-YLMETHYL)PIPERAZINE-1-CARBOXYLIC ACID ETHYL ESTER
CAS: 1228095-64-4
EnglishSynonyms: 4-(6-FLUOROQUINOLIN-2-YLMETHYL)PIPERAZINE-1-CARBOXYLIC ACID ETHYL ESTER ; ETHYL 4-[(6-FLUOROQUINOLIN-2-YL)METHYL]PIPERAZINE-1-CARBOXYLATE
pro_mdlNumber: MFCD16883051
pro_acceptors: 5
pro_donors: 0
pro_smile: CCOC(=O)N1CCN(CC1)Cc2ccc3cc(ccc3n2)F
InChi: InChI=1S/C17H20FN3O2/c1-2-23-17(22)21-9-7-20(8-10-21)12-15-5-3-13-11-14(18)4-6-16(13)19-15/h3-6,11H,2,7-10,12H2,1H3
InChiKey: InChIKey=NTWGYFBFZNYIOX-UHFFFAOYSA-N