2-[1-(2-BENZYL-1-OXO-1,2-DIHYDROISOQUINOLIN-4-YLMETHYL)PIPERIDIN-4-YL]ACETIC ACID METHYL ESTER

pro_cas
1228095-65-5
pro_cdbregno
CCD03259075
pro_formula
C25 H28 N2 O3
pro_molWeight
404.507

basic_info

Product_Name: 2-[1-(2-BENZYL-1-OXO-1,2-DIHYDROISOQUINOLIN-4-YLMETHYL)PIPERIDIN-4-YL]ACETIC ACID METHYL ESTER
CAS: 1228095-65-5
EnglishSynonyms: 2-[1-(2-BENZYL-1-OXO-1,2-DIHYDROISOQUINOLIN-4-YLMETHYL)PIPERIDIN-4-YL]ACETIC ACID METHYL ESTER ; METHYL 2-(1-[(2-BENZYL-1-OXO-1,2-DIHYDROISOQUINOLIN-4-YL)METHYL]PIPERIDIN-4-YL)ACETATE
pro_mdlNumber: MFCD16883052
pro_acceptors: 5
pro_donors: 0
pro_smile: COC(=O)CC1CCN(CC1)Cc2cn(c(=O)c3c2cccc3)Cc4ccccc4
InChi: InChI=1S/C25H28N2O3/c1-30-24(28)15-19-11-13-26(14-12-19)17-21-18-27(16-20-7-3-2-4-8-20)25(29)23-10-6-5-9-22(21)23/h2-10,18-19H,11-17H2,1H3
InChiKey: InChIKey=PCCCFYQYEUOTJN-UHFFFAOYSA-N