5-METHOXY-1-(PIPERAZIN-1-YL)ISOQUINOLINE HYDROCHLORIDE

pro_cas
1228095-66-6
pro_cdbregno
CCD03259078
pro_formula
C14 H17 N3 O . Cl H
pro_molWeight
279.769

basic_info

Product_Name: 5-METHOXY-1-(PIPERAZIN-1-YL)ISOQUINOLINE HYDROCHLORIDE
CAS: 1228095-66-6
EnglishSynonyms: 5-METHOXY-1-(PIPERAZIN-1-YL)ISOQUINOLINE HYDROCHLORIDE
pro_mdlNumber: MFCD16883055
pro_acceptors: 4
pro_donors: 1
pro_smile: COc1cccc2c1ccnc2N3CCNCC3.Cl
InChi: InChI=1S/C14H17N3O.ClH/c1-18-13-4-2-3-12-11(13)5-6-16-14(12)17-9-7-15-8-10-17;/h2-6,15H,7-10H2,1H3;1H
InChiKey: InChIKey=JYJKWPCFMLEQAU-UHFFFAOYSA-N