N-(2-AMINOETHYL)-5-FLUOROISOQUINOLIN-1-AMINE HYDROCHLORIDE

pro_cas
1228095-67-7
pro_cdbregno
CCD03259079
pro_formula
C11 H12 F N3 . Cl H
pro_molWeight
241.696

basic_info

Product_Name: N-(2-AMINOETHYL)-5-FLUOROISOQUINOLIN-1-AMINE HYDROCHLORIDE
CAS: 1228095-67-7
EnglishSynonyms: N-(2-AMINOETHYL)-5-FLUOROISOQUINOLIN-1-AMINE HYDROCHLORIDE
pro_mdlNumber: MFCD16883056
pro_acceptors: 3
pro_donors: 2
pro_smile: c1cc2c(ccnc2NCCN)c(c1)F.Cl
InChi: InChI=1S/C11H12FN3.ClH/c12-10-3-1-2-9-8(10)4-6-14-11(9)15-7-5-13;/h1-4,6H,5,7,13H2,(H,14,15);1H
InChiKey: InChIKey=VLLZCTRYRQZWGB-UHFFFAOYSA-N