N-(2-AMINOETHYL)-5-METHOXYISOQUINOLIN-1-AMINE HYDROCHLORIDE

pro_cas
1228095-68-8
pro_cdbregno
CCD03259080
pro_formula
C12 H15 N3 O . Cl H
pro_molWeight
253.731

basic_info

Product_Name: N-(2-AMINOETHYL)-5-METHOXYISOQUINOLIN-1-AMINE HYDROCHLORIDE
CAS: 1228095-68-8
EnglishSynonyms: N-(2-AMINOETHYL)-5-METHOXYISOQUINOLIN-1-AMINE HYDROCHLORIDE
pro_mdlNumber: MFCD16883057
pro_acceptors: 4
pro_donors: 2
pro_smile: COc1cccc2c1ccnc2NCCN.Cl
InChi: InChI=1S/C12H15N3O.ClH/c1-16-11-4-2-3-10-9(11)5-7-14-12(10)15-8-6-13;/h2-5,7H,6,8,13H2,1H3,(H,14,15);1H
InChiKey: InChIKey=CRGLXAOQIRYCBT-UHFFFAOYSA-N