N-(3-AMINOPROPYL)-7-FLUOROISOQUINOLIN-1-AMINE HYDROCHLORIDE

pro_cas
1228095-69-9
pro_cdbregno
CCD03259081
pro_formula
C12 H14 F N3 . Cl H
pro_molWeight
255.723

basic_info

Product_Name: N-(3-AMINOPROPYL)-7-FLUOROISOQUINOLIN-1-AMINE HYDROCHLORIDE
CAS: 1228095-69-9
EnglishSynonyms: N-(3-AMINOPROPYL)-7-FLUOROISOQUINOLIN-1-AMINE HYDROCHLORIDE
pro_mdlNumber: MFCD16883058
pro_acceptors: 3
pro_donors: 2
pro_smile: c1cc(cc2c1ccnc2NCCCN)F.Cl
InChi: InChI=1S/C12H14FN3.ClH/c13-10-3-2-9-4-7-16-12(11(9)8-10)15-6-1-5-14;/h2-4,7-8H,1,5-6,14H2,(H,15,16);1H
InChiKey: InChIKey=IFVVQWSZCAGFNB-UHFFFAOYSA-N