N-(2-AMINOETHYL)-7-FLUOROISOQUINOLIN-1-AMINE HYDROCHLORIDE

pro_cas
1228095-70-2
pro_cdbregno
CCD03259082
pro_formula
C11 H12 F N3 . Cl H
pro_molWeight
241.696

basic_info

Product_Name: N-(2-AMINOETHYL)-7-FLUOROISOQUINOLIN-1-AMINE HYDROCHLORIDE
CAS: 1228095-70-2
EnglishSynonyms: N-(2-AMINOETHYL)-7-FLUOROISOQUINOLIN-1-AMINE HYDROCHLORIDE
pro_mdlNumber: MFCD16883059
pro_acceptors: 3
pro_donors: 2
pro_smile: c1cc(cc2c1ccnc2NCCN)F.Cl
InChi: InChI=1S/C11H12FN3.ClH/c12-9-2-1-8-3-5-14-11(10(8)7-9)15-6-4-13;/h1-3,5,7H,4,6,13H2,(H,14,15);1H
InChiKey: InChIKey=OUTFTBDGGZZTNU-UHFFFAOYSA-N