5-BOC-4,6,7-TRIHYDRO-1,2,3-TRIAZOLO[1,5-A]PYRAZINE

pro_cas
1245782-69-7
pro_cdbregno
CCD03259084
pro_formula
C10 H16 N4 O2
pro_molWeight
224.262

basic_info

Product_Name: 5-BOC-4,6,7-TRIHYDRO-1,2,3-TRIAZOLO[1,5-A]PYRAZINE
CAS: 1245782-69-7
EnglishSynonyms: TERT-BUTYL 6,7-DIHYDRO-[1,2,3]TRIAZOLO[1,5-A]PYRAZINE-5(4H)-CARBOXYLATE ; 5-BOC-4,6,7-TRIHYDRO-1,2,3-TRIAZOLO[1,5-A]PYRAZINE ; 6,7-DIHYDRO-[1,2,3]TRIAZOLO[1,5-A]PYRAZINE-5(4H)-CARBOXYLIC ACID TERT-BUTYL ESTER
pro_mdlNumber: MFCD16883061
pro_acceptors: 6
pro_donors: 0
pro_smile: CC(C)(C)OC(=O)N1CCn2c(cnn2)C1
InChi: InChI=1S/C10H16N4O2/c1-10(2,3)16-9(15)13-4-5-14-8(7-13)6-11-12-14/h6H,4-5,7H2,1-3H3
InChiKey: InChIKey=WJRDRGQJIDIENS-UHFFFAOYSA-N