3-[4-(METHYLTHIO)PHENOXY]PROPIONIC ACID

pro_cas
18333-20-5
pro_cdbregno
CCD03259085
pro_formula
C10 H12 O3 S
pro_molWeight
212.268

basic_info

Product_Name: 3-[4-(METHYLTHIO)PHENOXY]PROPIONIC ACID
CAS: 18333-20-5
EnglishSynonyms: 3-[4-(METHYLTHIO)PHENOXY]PROPANOIC ACID ; 3-[4-(METHYLTHIO)PHENOXY]PROPIONIC ACID ; 3-[4-(METHYLSULFANYL)PHENOXY]PROPANOIC ACID
pro_mdlNumber: MFCD16883062
pro_acceptors: 3
pro_donors: 1
pro_smile: CSc1ccc(cc1)OCCC(=O)O
InChi: InChI=1S/C10H12O3S/c1-14-9-4-2-8(3-5-9)13-7-6-10(11)12/h2-5H,6-7H2,1H3,(H,11,12)
InChiKey: InChIKey=NMCXSNYBUXYMLO-UHFFFAOYSA-N