4-FLUORO-3-(TRIFLUOROMETHYLSULFONYL)BENZENESULFONYL CHLORIDE

pro_cas
1027345-07-8
pro_cdbregno
CCD03259086
pro_formula
C7 H3 Cl F4 O4 S2
pro_molWeight
326.674

basic_info

Product_Name: 4-FLUORO-3-(TRIFLUOROMETHYLSULFONYL)BENZENESULFONYL CHLORIDE
CAS: 1027345-07-8
EnglishSynonyms: 4-FLUORO-3-(TRIFLUOROMETHYLSULFONYL)BENZENESULFONYL CHLORIDE ; 4-FLUORO-3-((TRIFLUOROMETHYL)SULFONYL)BENZENE-1-SULFONYL CHLORIDE
pro_mdlNumber: MFCD16883063
pro_acceptors: 4
pro_donors: 0
pro_smile: c1cc(c(cc1S(=O)(=O)Cl)S(=O)(=O)C(F)(F)F)F
InChi: InChI=1S/C7H3ClF4O4S2/c8-18(15,16)4-1-2-5(9)6(3-4)17(13,14)7(10,11)12/h1-3H
InChiKey: InChIKey=SYZOKHJRIIDLOQ-UHFFFAOYSA-N