7-BENZYL-7-AZABICYCLO[2.2.1]HEPTANE-1-METHANAMINE

pro_cas
1193090-83-3
pro_cdbregno
CCD03259087
pro_formula
C14 H20 N2
pro_molWeight
216.326

basic_info

Product_Name: 7-BENZYL-7-AZABICYCLO[2.2.1]HEPTANE-1-METHANAMINE
CAS: 1193090-83-3
EnglishSynonyms: (7-BENZYL-7-AZABICYCLO[2.2.1]HEPTAN-1-YL)METHANAMINE ; 7-(PHENYLMETHYL)-7-AZABICYCLO[2.2.1]HEPTANE-1-METHANAMINE ; 7-BENZYL-7-AZABICYCLO[2.2.1]HEPTANE-1-METHANAMINE
pro_mdlNumber: MFCD16883064
pro_acceptors: 2
pro_donors: 1
pro_smile: c1ccc(cc1)CN2[C@H]3CC[C@@]2(CC3)CN
InChi: InChI=1S/C14H20N2/c15-11-14-8-6-13(7-9-14)16(14)10-12-4-2-1-3-5-12/h1-5,13H,6-11,15H2/t13-,14+
InChiKey: InChIKey=QTMONMDGPWWXOL-OKILXGFUSA-N