FMOC-6-FLUORO-D-TRYPTOPHAN

pro_cas
1219392-55-8 ;1257853-57-8
pro_cdbregno
CCD03259093
pro_formula
C26 H21 F N2 O4
pro_molWeight
444.46

basic_info

Product_Name: FMOC-6-FLUORO-D-TRYPTOPHAN
CAS: 1219392-55-8 ;1257853-57-8
EnglishSynonyms: FMOC-6-FLUORO-D-TRYPTOPHAN
pro_mdlNumber: MFCD16883070
pro_acceptors: 6
pro_donors: 3
pro_smile: c1ccc2c(c1)-c3ccccc3C2COC(=O)N[C@H](Cc4c[nH]c5c4ccc(c5)F)C(=O)O
InChi: InChI=1S/C26H21FN2O4/c27-16-9-10-17-15(13-28-23(17)12-16)11-24(25(30)31)29-26(32)33-14-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-10,12-13,22,24,28H,11,14H2,(H,29,32)(H,30,31)/t24-/m1/s1
InChiKey: InChIKey=ZNQAUDMHOJUTJL-XMMPIXPASA-N