ETHYL (1R,2S)-2-(BOC-AMINO)CYCLOPENTANECARBOXYLATE

pro_cas
1140972-29-7
pro_cdbregno
CCD03259097
pro_formula
C13 H23 N O4
pro_molWeight
257.328

basic_info

Product_Name: ETHYL (1R,2S)-2-(BOC-AMINO)CYCLOPENTANECARBOXYLATE
CAS: 1140972-29-7
EnglishSynonyms: ETHYL (1R,2S)-2-(BOC-AMINO)CYCLOPENTANECARBOXYLATE
pro_mdlNumber: MFCD16883074
pro_acceptors: 5
pro_donors: 1
pro_smile: CCOC(=O)[C@@H]1CCC[C@@H]1NC(=O)OC(C)(C)C
InChi: InChI=1S/C13H23NO4/c1-5-17-11(15)9-7-6-8-10(9)14-12(16)18-13(2,3)4/h9-10H,5-8H2,1-4H3,(H,14,16)/t9-,10+/m1/s1
InChiKey: InChIKey=MHYUFBHMDDIXTD-ZJUUUORDSA-N