3-PHENYL-4,5,6,7-TETRAHYDRO-1,2,3-TRIAZOLO[1,5-A]PYRAZINE HYDROCHLORIDE

pro_cas
1245782-72-2
pro_cdbregno
CCD03259100
pro_formula
C11 H12 N4 . Cl H
pro_molWeight
236.705

basic_info

Product_Name: 3-PHENYL-4,5,6,7-TETRAHYDRO-1,2,3-TRIAZOLO[1,5-A]PYRAZINE HYDROCHLORIDE
CAS: 1245782-72-2
EnglishSynonyms: 3-PHENYL-4,5,6,7-TETRAHYDRO-1,2,3-TRIAZOLO[1,5-A]PYRAZINE, HCL ; 3-PHENYL-4,5,6,7-TETRAHYDRO-1,2,3-TRIAZOLO[1,5-A]PYRAZINE HYDROCHLORIDE
pro_mdlNumber: MFCD16883077
pro_acceptors: 4
pro_donors: 1
pro_smile: c1ccc(cc1)c2c3n(nn2)CCNC3.Cl
InChi: InChI=1S/C11H12N4.ClH/c1-2-4-9(5-3-1)11-10-8-12-6-7-15(10)14-13-11;/h1-5,12H,6-8H2;1H
InChiKey: InChIKey=VIPHMUACPHIUCP-UHFFFAOYSA-N