3-AMINO-6-(AMINOMETHYL)-1,2,4-TRIAZIN-5(4H)-ONE DIHYDROCHLORIDE

pro_cas
1236162-31-4
pro_cdbregno
CCD03259101
pro_formula
C4 H7 N5 O . 2 Cl H
pro_molWeight
214.055

basic_info

Product_Name: 3-AMINO-6-(AMINOMETHYL)-1,2,4-TRIAZIN-5(4H)-ONE DIHYDROCHLORIDE
CAS: 1236162-31-4
EnglishSynonyms: 3-AMINO-6-(AMINOMETHYL)-1,2,4-TRIAZIN-5(4H)-ONE DI, HCL ; 3-AMINO-6-(AMINOMETHYL)-1,2,4-TRIAZIN-5(4H)-ONE DIHYDROCHLORIDE
pro_mdlNumber: MFCD16883078
pro_acceptors: 6
pro_donors: 3
pro_smile: C(c1c(=O)[nH]c(nn1)N)N.Cl.Cl
InChi: InChI=1S/C4H7N5O.2ClH/c5-1-2-3(10)7-4(6)9-8-2;;/h1,5H2,(H3,6,7,9,10);2*1H
InChiKey: InChIKey=SXJUKKCZXYUJKR-UHFFFAOYSA-N