C12 H10 Cl2 N2 O2


CAS: 1242260-10-1
pro_mdlNumber: MFCD16987444
pro_acceptors: 4
pro_donors: 1
pro_smile: CCOC(=O)c1cnc2c(ccc(c2c1N)Cl)Cl
InChi: InChI=1S/C12H10Cl2N2O2/c1-2-18-12(17)6-5-16-11-8(14)4-3-7(13)9(11)10(6)15/h3-5H,2H2,1H3,(H2,15,16)