4-AMINO-6-BROMO-8-METHYLQUINOLINE-3-CARBOXYLIC ACID

pro_cas
1242260-37-2
pro_cdbregno
CCD03259203
pro_formula
C11 H9 Br N2 O2
pro_molWeight
281.108

basic_info

Product_Name: 4-AMINO-6-BROMO-8-METHYLQUINOLINE-3-CARBOXYLIC ACID
CAS: 1242260-37-2
EnglishSynonyms: 4-AMINO-6-BROMO-8-METHYLQUINOLINE-3-CARBOXYLIC ACID
pro_mdlNumber: MFCD16987474
pro_acceptors: 4
pro_donors: 2
pro_smile: Cc1cc(cc2c1ncc(c2N)C(=O)O)Br
InChi: InChI=1S/C11H9BrN2O2/c1-5-2-6(12)3-7-9(13)8(11(15)16)4-14-10(5)7/h2-4H,1H3,(H2,13,14)(H,15,16)
InChiKey: InChIKey=ZNUWZBNGEVOJFO-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.