ETHYL 2-AMINO-4-CHLOROPYRIMIDINE-5-CARBOXYLATE

pro_cas
1240597-30-1
pro_cdbregno
CCD03259659
pro_formula
C7 H8 Cl N3 O2
pro_molWeight
201.612

basic_info

Product_Name: ETHYL 2-AMINO-4-CHLOROPYRIMIDINE-5-CARBOXYLATE
CAS: 1240597-30-1
EnglishSynonyms: ABBYPHARMA AP-10-1218 ; ETHYL 2-AMINO-4-CHLOROPYRIMIDINE-5-CARBOXYLATE
pro_mdlNumber: MFCD16987940
pro_acceptors: 5
pro_donors: 1
pro_smile: CCOC(=O)c1cnc(nc1Cl)N
InChi: InChI=1S/C7H8ClN3O2/c1-2-13-6(12)4-3-10-7(9)11-5(4)8/h3H,2H2,1H3,(H2,9,10,11)
InChiKey: InChIKey=QQXMRTNJTHNBJF-UHFFFAOYSA-N