2-AMINO-4-CHLOROPYRIMIDINE-5-CARBOXYLIC ACID

pro_cas
1240594-92-6
pro_cdbregno
CCD03259667
pro_formula
C5 H4 Cl N3 O2
pro_molWeight
173.559

basic_info

Product_Name: 2-AMINO-4-CHLOROPYRIMIDINE-5-CARBOXYLIC ACID
CAS: 1240594-92-6
EnglishSynonyms: 2-AMINO-4-CHLOROPYRIMIDINE-5-CARBOXYLIC ACID ; ABBYPHARMA AP-10-1234
pro_mdlNumber: MFCD16987948
pro_acceptors: 5
pro_donors: 2
pro_smile: c1c(c(nc(n1)N)Cl)C(=O)O
InChi: InChI=1S/C5H4ClN3O2/c6-3-2(4(10)11)1-8-5(7)9-3/h1H,(H,10,11)(H2,7,8,9)
InChiKey: InChIKey=YISUXFZYHBEMSR-UHFFFAOYSA-N