2-(5-BROMOPYRIDIN-2-YL)-2,2-DIFLUOROACETIC ACID

pro_cas
1240611-21-5
pro_cdbregno
CCD03260349
pro_formula
C7 H4 Br F2 N O2
pro_molWeight
252.014

basic_info

Product_Name: 2-(5-BROMOPYRIDIN-2-YL)-2,2-DIFLUOROACETIC ACID
CAS: 1240611-21-5
EnglishSynonyms: 2-(5-BROMOPYRIDIN-2-YL)-2,2-DIFLUOROACETIC ACID ; ABBYPHARMA AP-12-5751
pro_mdlNumber: MFCD16988631
pro_acceptors: 3
pro_donors: 1
pro_smile: c1cc(ncc1Br)C(C(=O)O)(F)F
InChi: InChI=1S/C7H4BrF2NO2/c8-4-1-2-5(11-3-4)7(9,10)6(12)13/h1-3H,(H,12,13)
InChiKey: InChIKey=MCXGNMNQGZVDRF-UHFFFAOYSA-N