(4-AMINOOXAZOL-2-YL)METHANOL

pro_cas
1240614-62-3
pro_cdbregno
CCD03261092
pro_formula
C4 H6 N2 O2
pro_molWeight
114.103

basic_info

Product_Name: (4-AMINOOXAZOL-2-YL)METHANOL
CAS: 1240614-62-3
EnglishSynonyms: (4-AMINOOXAZOL-2-YL)METHANOL
pro_mdlNumber: MFCD16989377
pro_acceptors: 4
pro_donors: 2
pro_smile: c1c(nc(o1)CO)N
InChi: InChI=1S/C4H6N2O2/c5-3-2-8-4(1-7)6-3/h2,7H,1,5H2
InChiKey: InChIKey=LJYYPZNKGIQISH-UHFFFAOYSA-N