(4-PHENYLOXAZOL-2-YL)METHANOL

pro_cas
162537-79-3
pro_cdbregno
CCD03261093
pro_formula
C10 H9 N O2
pro_molWeight
175.186

basic_info

Product_Name: (4-PHENYLOXAZOL-2-YL)METHANOL
CAS: 162537-79-3
EnglishSynonyms: (4-PHENYLOXAZOL-2-YL)METHANOL
pro_mdlNumber: MFCD16989378
pro_acceptors: 3
pro_donors: 1
pro_smile: c1ccc(cc1)c2coc(n2)CO
InChi: InChI=1S/C10H9NO2/c12-6-10-11-9(7-13-10)8-4-2-1-3-5-8/h1-5,7,12H,6H2
InChiKey: InChIKey=OSCQWZMTHOQKLU-UHFFFAOYSA-N